What is the 4-ETHYLTOLUENE?

4-ETHYLTOLUENE is , while it's Molecular Formula is C9H12. Used in the Coatings Industry: 4-Ethyltoluene is used as a solvent in the production of coatings, facilitating the application process and improving the final product's quality. Its solvent properties aid in the even distribution of pigments and resins, enhancing the durability and appearance of the coatings. Used in the Adhesives Industry: In the adhesives sector, 4-Ethyltoluene serves as a solvent that helps in the formulation of adhesives with specific bonding properties. It contributes to the adhesive's performance by ensuring a proper mix of components, which is crucial for the adhesive's effectiveness and longevity. Used in the Printing Inks Industry: 4-Ethyltoluene is utilized as a solvent in the production of printing inks, ensuring that the ink flows smoothly and adheres well to various surfaces. Its use in inks helps achieve vibrant colors and sharp print quality. Used as a Chemical Intermediate in Pharmaceutical Manufacturing: 4-Ethyltoluene plays a role as a chemical intermediate in the synthesis of pharmaceuticals, contributing to the development of new drugs and medicines. Its reactivity and stability make it a valuable component in the production process. Used as a Chemical Intermediate in Dye and Fragrance Production: 4-ETHYLTOLUENE is also employed as a chemical intermediate in the creation of dyes and fragrances, where it helps in the synthesis of various aromatic compounds that impart color and scent to products.

What is the CAS number for 4-ETHYLTOLUENE?

The CAS number of 4-ETHYLTOLUENE is 25550-14-5.

What is 4-ETHYLTOLUENE (25550-14-5) used for?

4-Ethyltoluene, with the molecular formula C9H12, is a chemical compound that exists as a clear, colorless liquid. It possesses a sweet odor and is recognized for its use as a solvent and chemical intermediate in various industrial applications.InChI:InChI=1/C9H12/c1-3-9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3

What is the 4-ETHYLTOLUENE?

4-ETHYLTOLUENE is , while it's Molecular Formula is C9H12. Used in the Coatings Industry: 4-Ethyltoluene is used as a solvent in the production of coatings, facilitating the application process and improving the final product's quality. Its solvent properties aid in the even distribution of pigments and resins, enhancing the durability and appearance of the coatings. Used in the Adhesives Industry: In the adhesives sector, 4-Ethyltoluene serves as a solvent that helps in the formulation of adhesives with specific bonding properties. It contributes to the adhesive's performance by ensuring a proper mix of components, which is crucial for the adhesive's effectiveness and longevity. Used in the Printing Inks Industry: 4-Ethyltoluene is utilized as a solvent in the production of printing inks, ensuring that the ink flows smoothly and adheres well to various surfaces. Its use in inks helps achieve vibrant colors and sharp print quality. Used as a Chemical Intermediate in Pharmaceutical Manufacturing: 4-Ethyltoluene plays a role as a chemical intermediate in the synthesis of pharmaceuticals, contributing to the development of new drugs and medicines. Its reactivity and stability make it a valuable component in the production process. Used as a Chemical Intermediate in Dye and Fragrance Production: 4-ETHYLTOLUENE is also employed as a chemical intermediate in the creation of dyes and fragrances, where it helps in the synthesis of various aromatic compounds that impart color and scent to products.

What is the CAS number for 4-ETHYLTOLUENE?

The CAS number of 4-ETHYLTOLUENE is 25550-14-5.

What is 4-ETHYLTOLUENE (25550-14-5) used for?

4-Ethyltoluene, with the molecular formula C9H12, is a chemical compound that exists as a clear, colorless liquid. It possesses a sweet odor and is recognized for its use as a solvent and chemical intermediate in various industrial applications.InChI:InChI=1/C9H12/c1-3-9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3

4-ETHYLTOLUENE

Chinese factory supply 4-ETHYLTOLUENE 25550-14-5 in stock with high standard

Molecular Formula: C9H12
Molecular Weight: 120.19
Vapor Pressure: 2.93mmHg at 25°C
Melting Point: -62 °C
Refractive Index: n20/D 1.495(lit.)
Boiling Point: 161.1 °C at 760 mmHg
Flash Point: 38.3 °C
PSA： 0.00000
Density: 0.867 g/cm³
LogP: 2.55740

4-ETHYLTOLUENE(Cas 25550-14-5) Usage

General Description

4-Ethyltoluene is a chemical compound with the molecular formula C9H12. It is a clear, colorless liquid with a sweet odor and is used primarily as a solvent in the production of coatings, adhesives, and printing inks. It is also used as a chemical intermediate in the manufacturing of pharmaceuticals, dyes, and fragrances. 4-Ethyltoluene is flammable and can be harmful if inhaled or ingested, causing irritation to the respiratory system and skin. It should be handled with care and proper protective equipment to prevent any adverse health effects.

InChI:InChI=1/C9H12/c1-3-9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3